C10H11N3O6 — CID 28741566
(2S,4R)-4-hydroxy-1-(4-nitro-1H-pyrrole-2-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 28741566) has the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-1-(4-nitro-1H-pyrrole-2-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-hydroxy-1-(4-nitro-1H-pyrrole-2-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 28741566 |
| Molecular Formula | C10H11N3O6 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (2S,4R)-4-hydroxy-1-(4-nitro-1H-pyrrole-2-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H](O)CN1C(=O)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C10H11N3O6/c14-6-2-8(10(16)17)12(4-6)9(15)7-1-5(3-11-7)13(18)19/h1,3,6,8,11,14H,2,4H2,(H,16,17)/t6-,8+/m1/s1 |
| InChIKey | MPXHJMYBMCQQNL-SVRRBLITSA-N |
| XLogP | -0.42 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|