C12H11FN2O6 — CID 64714768
(2S,4S)-1-(5-fluoro-2-nitrobenzoyl)-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 64714768) has the molecular formula C12H11FN2O6 and a molecular weight of 298.23 g/mol. Its IUPAC name is (2S,4S)-1-(5-fluoro-2-nitrobenzoyl)-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-(5-fluoro-2-nitrobenzoyl)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 64714768 |
| Molecular Formula | C12H11FN2O6 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (2S,4S)-1-(5-fluoro-2-nitrobenzoyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](O)CN1C(=O)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11FN2O6/c13-6-1-2-9(15(20)21)8(3-6)11(17)14-5-7(16)4-10(14)12(18)19/h1-3,7,10,16H,4-5H2,(H,18,19)/t7-,10-/m0/s1 |
| InChIKey | XRPUHIXOVYLICB-XVKPBYJWSA-N |
| XLogP | 0.39 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|