C12H12N2O6 — CID 16781804
4-hydroxy-1-(2-nitrobenzoyl)pyrrolidine-2-carboxylic acid (PubChem CID 16781804) has the molecular formula C12H12N2O6 and a molecular weight of 280.24 g/mol. Its IUPAC name is 4-hydroxy-1-(2-nitrobenzoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-hydroxy-1-(2-nitrobenzoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 16781804 |
| Molecular Formula | C12H12N2O6 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-hydroxy-1-(2-nitrobenzoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1C(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N2O6/c15-7-5-10(12(17)18)13(6-7)11(16)8-3-1-2-4-9(8)14(19)20/h1-4,7,10,15H,5-6H2,(H,17,18) |
| InChIKey | BNGVIFZGFBSHLR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|