C11H12N2O5 — CID 106671114
(3,4-dihydroxypyrrolidin-1-yl)-(2-nitrophenyl)methanone (PubChem CID 106671114) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is (3,4-dihydroxypyrrolidin-1-yl)-(2-nitrophenyl)methanone.
| Compound Name | (3,4-dihydroxypyrrolidin-1-yl)-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 106671114 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (3,4-dihydroxypyrrolidin-1-yl)-(2-nitrophenyl)methanone |
| SMILES | O=C(c1ccccc1[N+](=O)[O-])N1CC(O)C(O)C1 |
| InChI | InChI=1S/C11H12N2O5/c14-9-5-12(6-10(9)15)11(16)7-3-1-2-4-8(7)13(17)18/h1-4,9-10,14-15H,5-6H2 |
| InChIKey | BIKJFRBJVRTFIO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|