C11H11ClN2O5 — CID 106671006
(4-chloro-2-nitrophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone (PubChem CID 106671006) has the molecular formula C11H11ClN2O5 and a molecular weight of 286.67 g/mol. Its IUPAC name is (4-chloro-2-nitrophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone.
| Compound Name | (4-chloro-2-nitrophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 106671006 |
| Molecular Formula | C11H11ClN2O5 |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | (4-chloro-2-nitrophenyl)-(3,4-dihydroxypyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1[N+](=O)[O-])N1CC(O)C(O)C1 |
| InChI | InChI=1S/C11H11ClN2O5/c12-6-1-2-7(8(3-6)14(18)19)11(17)13-4-9(15)10(16)5-13/h1-3,9-10,15-16H,4-5H2 |
| InChIKey | REBIBGXALINCOL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|