C11H13Cl2N3O3 — CID 119934218
[(3S)-3-aminopyrrolidin-1-yl]-(4-chloro-2-nitrophenyl)methanone;hydrochloride (PubChem CID 119934218) has the molecular formula C11H13Cl2N3O3 and a molecular weight of 306.15 g/mol. Its IUPAC name is [(3S)-3-aminopyrrolidin-1-yl]-(4-chloro-2-nitrophenyl)methanone;hydrochloride.
| Compound Name | [(3S)-3-aminopyrrolidin-1-yl]-(4-chloro-2-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119934218 |
| Molecular Formula | C11H13Cl2N3O3 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | [(3S)-3-aminopyrrolidin-1-yl]-(4-chloro-2-nitrophenyl)methanone;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(C(=O)c2ccc(Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C11H12ClN3O3.ClH/c12-7-1-2-9(10(5-7)15(17)18)11(16)14-4-3-8(13)6-14;/h1-2,5,8H,3-4,6,13H2;1H/t8-;/m0./s1 |
| InChIKey | RWLADWKXGUCHCL-QRPNPIFTSA-N |
| XLogP | 1.84 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|