C20H18Cl2N4O6 — CID 4601301
[4-(4-chloro-2-nitrobenzoyl)-2,5-dimethylpiperazin-1-yl]-(4-chloro-2-nitrophenyl)methanone (PubChem CID 4601301) has the molecular formula C20H18Cl2N4O6 and a molecular weight of 481.29 g/mol. Its IUPAC name is [4-(4-chloro-2-nitrobenzoyl)-2,5-dimethylpiperazin-1-yl]-(4-chloro-2-nitrophenyl)methanone.
| Compound Name | [4-(4-chloro-2-nitrobenzoyl)-2,5-dimethylpiperazin-1-yl]-(4-chloro-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 4601301 |
| Molecular Formula | C20H18Cl2N4O6 |
| Molecular Weight | 481.29 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | [4-(4-chloro-2-nitrobenzoyl)-2,5-dimethylpiperazin-1-yl]-(4-chloro-2-nitrophenyl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(Cl)cc2[N+](=O)[O-])C(C)CN1C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18Cl2N4O6/c1-11-9-24(20(28)16-6-4-14(22)8-18(16)26(31)32)12(2)10-23(11)19(27)15-5-3-13(21)7-17(15)25(29)30/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | DBJTUDZOKODSPW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|