C13H14BrClN2O4 — CID 81214135
[2-(bromomethyl)-5-methylmorpholin-4-yl]-(4-chloro-2-nitrophenyl)methanone (PubChem CID 81214135) has the molecular formula C13H14BrClN2O4 and a molecular weight of 377.62 g/mol. Its IUPAC name is [2-(bromomethyl)-5-methylmorpholin-4-yl]-(4-chloro-2-nitrophenyl)methanone.
| Compound Name | [2-(bromomethyl)-5-methylmorpholin-4-yl]-(4-chloro-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 81214135 |
| Molecular Formula | C13H14BrClN2O4 |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | [2-(bromomethyl)-5-methylmorpholin-4-yl]-(4-chloro-2-nitrophenyl)methanone |
| SMILES | CC1COC(CBr)CN1C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14BrClN2O4/c1-8-7-21-10(5-14)6-16(8)13(18)11-3-2-9(15)4-12(11)17(19)20/h2-4,8,10H,5-7H2,1H3 |
| InChIKey | YCPLHYUQLQVTEQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|