C13H18BrNO3 — CID 81212071
[2-(bromomethyl)-5-methylmorpholin-4-yl]-(2,5-dimethylfuran-3-yl)methanone (PubChem CID 81212071) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is [2-(bromomethyl)-5-methylmorpholin-4-yl]-(2,5-dimethylfuran-3-yl)methanone.
| Compound Name | [2-(bromomethyl)-5-methylmorpholin-4-yl]-(2,5-dimethylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 81212071 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | [2-(bromomethyl)-5-methylmorpholin-4-yl]-(2,5-dimethylfuran-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CC(CBr)OCC2C)c(C)o1 |
| InChI | InChI=1S/C13H18BrNO3/c1-8-7-17-11(5-14)6-15(8)13(16)12-4-9(2)18-10(12)3/h4,8,11H,5-7H2,1-3H3 |
| InChIKey | XVSHRLFGWAATEQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|