About (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone
(2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone (PubChem CID 128927247) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone.
Molecular Properties
| Compound Name | (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone |
| PubChem CID | 128927247 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CC(C)OCC2C)c(C)o1 |
| InChI | InChI=1S/C13H19NO3/c1-8-7-16-10(3)6-14(8)13(15)12-5-9(2)17-11(12)4/h5,8,10H,6-7H2,1-4H3 |
| InChIKey | JNEJUJDNHKCRQK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone?
The IUPAC name of (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone (CID 128927247) is (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone.
What is the SMILES notation for (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone?
The canonical SMILES for (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone is Cc1cc(C(=O)N2CC(C)OCC2C)c(C)o1.
What is the InChIKey of (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone?
The InChIKey is JNEJUJDNHKCRQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-8-7-16-10(3)6-14(8)13(15)12-5-9(2)17-11(12)4/h5,8,10H,6-7H2,1-4H3.
What are the key properties of (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone?
(2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone has a molecular weight of 237.30 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethylfuran-3-yl)-(2,5-dimethylmorpholin-4-yl)methanone is sourced from PubChem (CID 128927247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).