C14H18ClN3O3 — CID 86815183
(4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-(2-nitrophenyl)methanone;hydrochloride (PubChem CID 86815183) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is (4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-(2-nitrophenyl)methanone;hydrochloride.
| Compound Name | (4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-(2-nitrophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 86815183 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-(2-nitrophenyl)methanone;hydrochloride |
| SMILES | Cl.NC1CCC2CN(C(=O)c3ccccc3[N+](=O)[O-])CC12 |
| InChI | InChI=1S/C14H17N3O3.ClH/c15-12-6-5-9-7-16(8-11(9)12)14(18)10-3-1-2-4-13(10)17(19)20;/h1-4,9,11-12H,5-8,15H2;1H |
| InChIKey | MSKGMJPOAJIJJP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|