C10H10N4O6 — CID 107432849
1-(4-nitro-1H-pyrrole-2-carbonyl)-5-oxopiperazine-2-carboxylic acid (PubChem CID 107432849) has the molecular formula C10H10N4O6 and a molecular weight of 282.21 g/mol. Its IUPAC name is 1-(4-nitro-1H-pyrrole-2-carbonyl)-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-(4-nitro-1H-pyrrole-2-carbonyl)-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107432849 |
| Molecular Formula | C10H10N4O6 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-(4-nitro-1H-pyrrole-2-carbonyl)-5-oxopiperazine-2-carboxylic acid |
| SMILES | O=C1CN(C(=O)c2cc([N+](=O)[O-])c[nH]2)C(C(=O)O)CN1 |
| InChI | InChI=1S/C10H10N4O6/c15-8-4-13(7(3-12-8)10(17)18)9(16)6-1-5(2-11-6)14(19)20/h1-2,7,11H,3-4H2,(H,12,15)(H,17,18) |
| InChIKey | XQXJOCWCIIMREU-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 145.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|