C10H11N5O6 — CID 107432947
1-[2-(4-nitropyrazol-1-yl)acetyl]-5-oxopiperazine-2-carboxylic acid (PubChem CID 107432947) has the molecular formula C10H11N5O6 and a molecular weight of 297.23 g/mol. Its IUPAC name is 1-[2-(4-nitropyrazol-1-yl)acetyl]-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-[2-(4-nitropyrazol-1-yl)acetyl]-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107432947 |
| Molecular Formula | C10H11N5O6 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-[2-(4-nitropyrazol-1-yl)acetyl]-5-oxopiperazine-2-carboxylic acid |
| SMILES | O=C1CN(C(=O)Cn2cc([N+](=O)[O-])cn2)C(C(=O)O)CN1 |
| InChI | InChI=1S/C10H11N5O6/c16-8-4-14(7(2-11-8)10(18)19)9(17)5-13-3-6(1-12-13)15(20)21/h1,3,7H,2,4-5H2,(H,11,16)(H,18,19) |
| InChIKey | GLJCZGWTDUMAGZ-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|