C10H9N3O6S — CID 107432774
1-(5-nitrothiophene-3-carbonyl)-5-oxopiperazine-2-carboxylic acid (PubChem CID 107432774) has the molecular formula C10H9N3O6S and a molecular weight of 299.26 g/mol. Its IUPAC name is 1-(5-nitrothiophene-3-carbonyl)-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-(5-nitrothiophene-3-carbonyl)-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107432774 |
| Molecular Formula | C10H9N3O6S |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 1-(5-nitrothiophene-3-carbonyl)-5-oxopiperazine-2-carboxylic acid |
| SMILES | O=C1CN(C(=O)c2csc([N+](=O)[O-])c2)C(C(=O)O)CN1 |
| InChI | InChI=1S/C10H9N3O6S/c14-7-3-12(6(2-11-7)10(16)17)9(15)5-1-8(13(18)19)20-4-5/h1,4,6H,2-3H2,(H,11,14)(H,16,17) |
| InChIKey | GMGPEUUSLOMSED-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|