C11H15N3O3S — CID 64979919
(2,5-dimethylpiperazin-1-yl)-(5-nitrothiophen-3-yl)methanone (PubChem CID 64979919) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is (2,5-dimethylpiperazin-1-yl)-(5-nitrothiophen-3-yl)methanone.
| Compound Name | (2,5-dimethylpiperazin-1-yl)-(5-nitrothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 64979919 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (2,5-dimethylpiperazin-1-yl)-(5-nitrothiophen-3-yl)methanone |
| SMILES | CC1CN(C(=O)c2csc([N+](=O)[O-])c2)C(C)CN1 |
| InChI | InChI=1S/C11H15N3O3S/c1-7-5-13(8(2)4-12-7)11(15)9-3-10(14(16)17)18-6-9/h3,6-8,12H,4-5H2,1-2H3 |
| InChIKey | AWLSUBUXYWPUPR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|