C13H18N2O3 — CID 107702962
(3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone (PubChem CID 107702962) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone.
| Compound Name | (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 107702962 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(O)cc(O)c2)C(C)CN1 |
| InChI | InChI=1S/C13H18N2O3/c1-8-7-15(9(2)6-14-8)13(18)10-3-11(16)5-12(17)4-10/h3-5,8-9,14,16-17H,6-7H2,1-2H3 |
| InChIKey | FDDYWQIGXGYNDW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |