About (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone
(3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone (PubChem CID 107702962) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone |
| PubChem CID | 107702962 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(O)cc(O)c2)C(C)CN1 |
| InChI | InChI=1S/C13H18N2O3/c1-8-7-15(9(2)6-14-8)13(18)10-3-11(16)5-12(17)4-10/h3-5,8-9,14,16-17H,6-7H2,1-2H3 |
| InChIKey | FDDYWQIGXGYNDW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone?
The IUPAC name of (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone (CID 107702962) is (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone.
What is the SMILES notation for (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone?
The canonical SMILES for (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone is CC1CN(C(=O)c2cc(O)cc(O)c2)C(C)CN1.
What is the InChIKey of (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone?
The InChIKey is FDDYWQIGXGYNDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3/c1-8-7-15(9(2)6-14-8)13(18)10-3-11(16)5-12(17)4-10/h3-5,8-9,14,16-17H,6-7H2,1-2H3.
What are the key properties of (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone?
(3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone has a molecular weight of 250.30 g/mol, XLogP of 0.92, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dihydroxyphenyl)-(2,5-dimethylpiperazin-1-yl)methanone is sourced from PubChem (CID 107702962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).