C13H16BrClN2O — CID 64979323
(5-bromo-2-chlorophenyl)-(2,5-dimethylpiperazin-1-yl)methanone (PubChem CID 64979323) has the molecular formula C13H16BrClN2O and a molecular weight of 331.64 g/mol. Its IUPAC name is (5-bromo-2-chlorophenyl)-(2,5-dimethylpiperazin-1-yl)methanone.
| Compound Name | (5-bromo-2-chlorophenyl)-(2,5-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 64979323 |
| Molecular Formula | C13H16BrClN2O |
| Molecular Weight | 331.64 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | (5-bromo-2-chlorophenyl)-(2,5-dimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(Br)ccc2Cl)C(C)CN1 |
| InChI | InChI=1S/C13H16BrClN2O/c1-8-7-17(9(2)6-16-8)13(18)11-5-10(14)3-4-12(11)15/h3-5,8-9,16H,6-7H2,1-2H3 |
| InChIKey | UFAUSLWVULSZOK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |