C13H17Cl2N3O — CID 64979775
N-(2,5-dichlorophenyl)-2,5-dimethylpiperazine-1-carboxamide (PubChem CID 64979775) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2,5-dimethylpiperazine-1-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-2,5-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 64979775 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2,5-dimethylpiperazine-1-carboxamide |
| SMILES | CC1CN(C(=O)Nc2cc(Cl)ccc2Cl)C(C)CN1 |
| InChI | InChI=1S/C13H17Cl2N3O/c1-8-7-18(9(2)6-16-8)13(19)17-12-5-10(14)3-4-11(12)15/h3-5,8-9,16H,6-7H2,1-2H3,(H,17,19) |
| InChIKey | CZYXHNCQVRFAIU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |