C15H19Cl2N3O — CID 66242943
N-(2,5-dichlorophenyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 66242943) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 66242943 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CC1(C)C2CNCC2CN1C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H19Cl2N3O/c1-15(2)11-7-18-6-9(11)8-20(15)14(21)19-13-5-10(16)3-4-12(13)17/h3-5,9,11,18H,6-8H2,1-2H3,(H,19,21) |
| InChIKey | CJCQJPQHQOXLLR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |