C14H18ClN3O — CID 66208028
N-(2-chlorophenyl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 66208028) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 66208028 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-(2-chlorophenyl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CC1C2CNCC2CN1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H18ClN3O/c1-9-11-7-16-6-10(11)8-18(9)14(19)17-13-5-3-2-4-12(13)15/h2-5,9-11,16H,6-8H2,1H3,(H,17,19) |
| InChIKey | QWVIRTLPDOLSDO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |