C15H18Cl2N2O — CID 66212663
2-(3,4-dichlorophenyl)-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone (PubChem CID 66212663) has the molecular formula C15H18Cl2N2O and a molecular weight of 313.23 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone |
|---|---|
| PubChem CID | 66212663 |
| Molecular Formula | C15H18Cl2N2O |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone |
| SMILES | CC1C2CNCC2CN1C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H18Cl2N2O/c1-9-12-7-18-6-11(12)8-19(9)15(20)5-10-2-3-13(16)14(17)4-10/h2-4,9,11-12,18H,5-8H2,1H3 |
| InChIKey | LGFGONKYGMIMFN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |