C12H18N4O — CID 114022794
(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1-methylimidazol-4-yl)methanone (PubChem CID 114022794) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is (4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1-methylimidazol-4-yl)methanone.
| Compound Name | (4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1-methylimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 114022794 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1-methylimidazol-4-yl)methanone |
| SMILES | CC1C2CNCC2CN1C(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C12H18N4O/c1-8-10-4-13-3-9(10)5-16(8)12(17)11-6-15(2)7-14-11/h6-10,13H,3-5H2,1-2H3 |
| InChIKey | PNHARPXBDPPGJZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |