C14H22N4O — CID 66211109
(3-ethyl-1-methylpyrazol-5-yl)-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 66211109) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (3-ethyl-1-methylpyrazol-5-yl)-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | (3-ethyl-1-methylpyrazol-5-yl)-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 66211109 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (3-ethyl-1-methylpyrazol-5-yl)-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CCc1cc(C(=O)N2CC3CNCC3C2C)n(C)n1 |
| InChI | InChI=1S/C14H22N4O/c1-4-11-5-13(17(3)16-11)14(19)18-8-10-6-15-7-12(10)9(18)2/h5,9-10,12,15H,4,6-8H2,1-3H3 |
| InChIKey | UQTASHBZXOYLOB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |