C10H15N5O — CID 66209764
(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 66209764) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is (4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1H-1,2,4-triazol-5-yl)methanone.
| Compound Name | (4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1H-1,2,4-triazol-5-yl)methanone |
|---|---|
| PubChem CID | 66209764 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | (4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | CC1C2CNCC2CN1C(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C10H15N5O/c1-6-8-3-11-2-7(8)4-15(6)10(16)9-12-5-13-14-9/h5-8,11H,2-4H2,1H3,(H,12,13,14) |
| InChIKey | DUSCYEHZHVEOLJ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |