C13H20N2O — CID 77114896
1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)hexa-2,4-dien-1-one (PubChem CID 77114896) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)hexa-2,4-dien-1-one.
| Compound Name | 1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 77114896 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)hexa-2,4-dien-1-one |
| SMILES | CC=CC=CC(=O)N1CC2CNCC2C1C |
| InChI | InChI=1S/C13H20N2O/c1-3-4-5-6-13(16)15-9-11-7-14-8-12(11)10(15)2/h3-6,10-12,14H,7-9H2,1-2H3 |
| InChIKey | JKJBVSRWVJJQLZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|