C12H22N2O3S — CID 66211877
2-methyl-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-methylsulfonylpropan-1-one (PubChem CID 66211877) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-methyl-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-methylsulfonylpropan-1-one.
| Compound Name | 2-methyl-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-methylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 66211877 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-methyl-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-methylsulfonylpropan-1-one |
| SMILES | CC1C2CNCC2CN1C(=O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C12H22N2O3S/c1-8-10-6-13-5-9(10)7-14(8)11(15)12(2,3)18(4,16)17/h8-10,13H,5-7H2,1-4H3 |
| InChIKey | CKZVTQUHPUKELY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |