C10H15F3N2O — CID 66213431
3,3,3-trifluoro-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-1-one (PubChem CID 66213431) has the molecular formula C10H15F3N2O and a molecular weight of 236.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-1-one.
| Compound Name | 3,3,3-trifluoro-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 66213431 |
| Molecular Formula | C10H15F3N2O |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3,3,3-trifluoro-1-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-1-one |
| SMILES | CC1C2CNCC2CN1C(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O/c1-6-8-4-14-3-7(8)5-15(6)9(16)2-10(11,12)13/h6-8,14H,2-5H2,1H3 |
| InChIKey | FAHCQJUUWWZZCV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |