C11H16N4O — CID 66210524
1H-imidazol-5-yl-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 66210524) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 1H-imidazol-5-yl-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | 1H-imidazol-5-yl-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 66210524 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1H-imidazol-5-yl-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CC1C2CNCC2CN1C(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C11H16N4O/c1-7-9-3-12-2-8(9)5-15(7)11(16)10-4-13-6-14-10/h4,6-9,12H,2-3,5H2,1H3,(H,13,14) |
| InChIKey | WDJWGBZGFLUEJA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |