C16H21Cl2N3O — CID 97061970
(4aR,8aS)-N-(2,5-dichlorophenyl)-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide (PubChem CID 97061970) has the molecular formula C16H21Cl2N3O and a molecular weight of 342.27 g/mol. Its IUPAC name is (4aR,8aS)-N-(2,5-dichlorophenyl)-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide.
| Compound Name | (4aR,8aS)-N-(2,5-dichlorophenyl)-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 97061970 |
| Molecular Formula | C16H21Cl2N3O |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (4aR,8aS)-N-(2,5-dichlorophenyl)-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide |
| SMILES | CN1CC[C@H]2[C@H](CCCN2C(=O)Nc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C16H21Cl2N3O/c1-20-8-6-15-11(10-20)3-2-7-21(15)16(22)19-14-9-12(17)4-5-13(14)18/h4-5,9,11,15H,2-3,6-8,10H2,1H3,(H,19,22)/t11-,15+/m1/s1 |
| InChIKey | SIWHKQFZCQBYBS-ABAIWWIYSA-N |
| XLogP | 3.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |