C18H25N3O2 — CID 96997650
(4aR,8aS)-N-(4-acetylphenyl)-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide (PubChem CID 96997650) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (4aR,8aS)-N-(4-acetylphenyl)-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide.
| Compound Name | (4aR,8aS)-N-(4-acetylphenyl)-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 96997650 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (4aR,8aS)-N-(4-acetylphenyl)-6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-1-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)N2CCC[C@@H]3CN(C)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-13(22)14-5-7-16(8-6-14)19-18(23)21-10-3-4-15-12-20(2)11-9-17(15)21/h5-8,15,17H,3-4,9-12H2,1-2H3,(H,19,23)/t15-,17+/m1/s1 |
| InChIKey | YPRXFFKUTZWTDP-WBVHZDCISA-N |
| XLogP | 2.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |