C18H23N5O3 — CID 167843153
(4aS,7aS)-6-methyl-N-[4-(5-oxo-4H-1,3,4-oxadiazin-2-yl)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide (PubChem CID 167843153) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is (4aS,7aS)-6-methyl-N-[4-(5-oxo-4H-1,3,4-oxadiazin-2-yl)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide.
| Compound Name | (4aS,7aS)-6-methyl-N-[4-(5-oxo-4H-1,3,4-oxadiazin-2-yl)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 167843153 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (4aS,7aS)-6-methyl-N-[4-(5-oxo-4H-1,3,4-oxadiazin-2-yl)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide |
| SMILES | CN1C[C@@H]2CCCN(C(=O)Nc3ccc(C4=NNC(=O)CO4)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C18H23N5O3/c1-22-9-13-3-2-8-23(15(13)10-22)18(25)19-14-6-4-12(5-7-14)17-21-20-16(24)11-26-17/h4-7,13,15H,2-3,8-11H2,1H3,(H,19,25)(H,20,24)/t13-,15+/m0/s1 |
| InChIKey | KFYUKPWTXWRPHA-DZGCQCFKSA-N |
| XLogP | 1.05 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |