C22H33N3O2 — CID 87035128
2-cyclopentyl-N-[4-[2-(diethylamino)-2-oxoethyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 87035128) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-cyclopentyl-N-[4-[2-(diethylamino)-2-oxoethyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-cyclopentyl-N-[4-[2-(diethylamino)-2-oxoethyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 87035128 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 2-cyclopentyl-N-[4-[2-(diethylamino)-2-oxoethyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)Cc1ccc(NC(=O)N2CCCC2C2CCCC2)cc1 |
| InChI | InChI=1S/C22H33N3O2/c1-3-24(4-2)21(26)16-17-11-13-19(14-12-17)23-22(27)25-15-7-10-20(25)18-8-5-6-9-18/h11-14,18,20H,3-10,15-16H2,1-2H3,(H,23,27) |
| InChIKey | QKWIJUTVLYMDMP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |