C14H22N4OS — CID 128911195
(4aS,7aS)-N-(2,4-dimethyl-1,3-thiazol-5-yl)-6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide (PubChem CID 128911195) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is (4aS,7aS)-N-(2,4-dimethyl-1,3-thiazol-5-yl)-6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide.
| Compound Name | (4aS,7aS)-N-(2,4-dimethyl-1,3-thiazol-5-yl)-6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 128911195 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (4aS,7aS)-N-(2,4-dimethyl-1,3-thiazol-5-yl)-6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-carboxamide |
| SMILES | Cc1nc(C)c(NC(=O)N2CCC[C@H]3CN(C)C[C@H]32)s1 |
| InChI | InChI=1S/C14H22N4OS/c1-9-13(20-10(2)15-9)16-14(19)18-6-4-5-11-7-17(3)8-12(11)18/h11-12H,4-8H2,1-3H3,(H,16,19)/t11-,12+/m0/s1 |
| InChIKey | DNTAPSVJVYSQBJ-NWDGAFQWSA-N |
| XLogP | 2.32 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |