C20H28N2O5S — CID 95783452
diethyl 5-[[(4aS,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 95783452) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is diethyl 5-[[(4aS,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(4aS,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 95783452 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | diethyl 5-[[(4aS,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)N2CCC[C@@H]3CCC[C@H]32)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C20H28N2O5S/c1-4-26-18(23)15-12(3)16(19(24)27-5-2)28-17(15)21-20(25)22-11-7-9-13-8-6-10-14(13)22/h13-14H,4-11H2,1-3H3,(H,21,25)/t13-,14+/m0/s1 |
| InChIKey | VAMKLYYZKFNNPB-UONOGXRCSA-N |
| XLogP | 4.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |