C25H31FN4O — CID 59558062
N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(4-fluorophenyl)piperidine-1-carboxamide (PubChem CID 59558062) has the molecular formula C25H31FN4O and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(4-fluorophenyl)piperidine-1-carboxamide.
| Compound Name | N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(4-fluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 59558062 |
| Molecular Formula | C25H31FN4O |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(4-fluorophenyl)piperidine-1-carboxamide |
| SMILES | CN1C[C@H]2CCN(c3ccc(NC(=O)N4CCC(c5ccc(F)cc5)CC4)cc3)[C@H]2C1 |
| InChI | InChI=1S/C25H31FN4O/c1-28-16-20-12-15-30(24(20)17-28)23-8-6-22(7-9-23)27-25(31)29-13-10-19(11-14-29)18-2-4-21(26)5-3-18/h2-9,19-20,24H,10-17H2,1H3,(H,27,31)/t20-,24+/m1/s1 |
| InChIKey | BQBRDHIBMUYOQW-YKSBVNFPSA-N |
| XLogP | 4.38 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |