C26H33ClN4O — CID 59558081
N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-2-methylphenyl]-4-(4-chlorophenyl)piperidine-1-carboxamide (PubChem CID 59558081) has the molecular formula C26H33ClN4O and a molecular weight of 453.03 g/mol. Its IUPAC name is N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-2-methylphenyl]-4-(4-chlorophenyl)piperidine-1-carboxamide.
| Compound Name | N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-2-methylphenyl]-4-(4-chlorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 59558081 |
| Molecular Formula | C26H33ClN4O |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-2-methylphenyl]-4-(4-chlorophenyl)piperidine-1-carboxamide |
| SMILES | Cc1cc(N2CC[C@@H]3CN(C)C[C@@H]32)ccc1NC(=O)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H33ClN4O/c1-18-15-23(31-14-11-21-16-29(2)17-25(21)31)7-8-24(18)28-26(32)30-12-9-20(10-13-30)19-3-5-22(27)6-4-19/h3-8,15,20-21,25H,9-14,16-17H2,1-2H3,(H,28,32)/t21-,25+/m1/s1 |
| InChIKey | DPKUQRQAOVRFMO-BWKNWUBXSA-N |
| XLogP | 5.20 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |