C25H33ClN4O — CID 143182310
4-(4-chlorophenyl)-N-[4-[3-methyl-4-(methylaminomethyl)pyrrolidin-1-yl]phenyl]piperidine-1-carboxamide (PubChem CID 143182310) has the molecular formula C25H33ClN4O and a molecular weight of 441.02 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-[3-methyl-4-(methylaminomethyl)pyrrolidin-1-yl]phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-[4-[3-methyl-4-(methylaminomethyl)pyrrolidin-1-yl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143182310 |
| Molecular Formula | C25H33ClN4O |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-[3-methyl-4-(methylaminomethyl)pyrrolidin-1-yl]phenyl]piperidine-1-carboxamide |
| SMILES | CNCC1CN(c2ccc(NC(=O)N3CCC(c4ccc(Cl)cc4)CC3)cc2)CC1C |
| InChI | InChI=1S/C25H33ClN4O/c1-18-16-30(17-21(18)15-27-2)24-9-7-23(8-10-24)28-25(31)29-13-11-20(12-14-29)19-3-5-22(26)6-4-19/h3-10,18,20-21,27H,11-17H2,1-2H3,(H,28,31) |
| InChIKey | LJVNBSSBYFDEHD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|