C27H31ClN6O — CID 58867411
4-(4-chlorophenyl)-N-[4-[(3R)-3-[methyl(pyrimidin-2-yl)amino]pyrrolidin-1-yl]phenyl]piperidine-1-carboxamide (PubChem CID 58867411) has the molecular formula C27H31ClN6O and a molecular weight of 491.04 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-[(3R)-3-[methyl(pyrimidin-2-yl)amino]pyrrolidin-1-yl]phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-[4-[(3R)-3-[methyl(pyrimidin-2-yl)amino]pyrrolidin-1-yl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58867411 |
| Molecular Formula | C27H31ClN6O |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-[(3R)-3-[methyl(pyrimidin-2-yl)amino]pyrrolidin-1-yl]phenyl]piperidine-1-carboxamide |
| SMILES | CN(c1ncccn1)[C@@H]1CCN(c2ccc(NC(=O)N3CCC(c4ccc(Cl)cc4)CC3)cc2)C1 |
| InChI | InChI=1S/C27H31ClN6O/c1-32(26-29-14-2-15-30-26)25-13-18-34(19-25)24-9-7-23(8-10-24)31-27(35)33-16-11-21(12-17-33)20-3-5-22(28)6-4-20/h2-10,14-15,21,25H,11-13,16-19H2,1H3,(H,31,35)/t25-/m1/s1 |
| InChIKey | APUYTCRMOCESSF-RUZDIDTESA-N |
| XLogP | 5.26 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|