C24H30F3N5O — CID 58867740
N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 58867740) has the molecular formula C24H30F3N5O and a molecular weight of 461.53 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58867740 |
| Molecular Formula | C24H30F3N5O |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)N3CCN(c4ccccc4C(F)(F)F)CC3)cc2)C1 |
| InChI | InChI=1S/C24H30F3N5O/c1-29(2)20-11-12-32(17-20)19-9-7-18(8-10-19)28-23(33)31-15-13-30(14-16-31)22-6-4-3-5-21(22)24(25,26)27/h3-10,20H,11-17H2,1-2H3,(H,28,33) |
| InChIKey | WFEAYISFBITEOH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|