C25H34N4O — CID 58866822
N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-(4-methylphenyl)piperidine-1-carboxamide (PubChem CID 58866822) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-(4-methylphenyl)piperidine-1-carboxamide.
| Compound Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-(4-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58866822 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-(4-methylphenyl)piperidine-1-carboxamide |
| SMILES | Cc1ccc(C2CCN(C(=O)Nc3ccc(N4CCC(N(C)C)C4)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H34N4O/c1-19-4-6-20(7-5-19)21-12-15-28(16-13-21)25(30)26-22-8-10-23(11-9-22)29-17-14-24(18-29)27(2)3/h4-11,21,24H,12-18H2,1-3H3,(H,26,30) |
| InChIKey | OWTZZJYNJORJJI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|