C26H34N4O3 — CID 58867051
N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-(4-methylphenoxy)piperidine-1-carboxamide (PubChem CID 58867051) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-(4-methylphenoxy)piperidine-1-carboxamide.
| Compound Name | N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-(4-methylphenoxy)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58867051 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-(4-methylphenoxy)piperidine-1-carboxamide |
| SMILES | CC(=O)N(C)C1CCN(c2ccc(NC(=O)N3CCC(Oc4ccc(C)cc4)CC3)cc2)C1 |
| InChI | InChI=1S/C26H34N4O3/c1-19-4-10-24(11-5-19)33-25-13-16-29(17-14-25)26(32)27-21-6-8-22(9-7-21)30-15-12-23(18-30)28(3)20(2)31/h4-11,23,25H,12-18H2,1-3H3,(H,27,32) |
| InChIKey | DQDNASFFEBGLBR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|