C26H31N3O3 — CID 58867223
N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-cyclohex-2-en-1-yloxybenzamide (PubChem CID 58867223) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-cyclohex-2-en-1-yloxybenzamide.
| Compound Name | N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-cyclohex-2-en-1-yloxybenzamide |
|---|---|
| PubChem CID | 58867223 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-cyclohex-2-en-1-yloxybenzamide |
| SMILES | CC(=O)N(C)C1CCN(c2ccc(NC(=O)c3ccc(OC4C=CCCC4)cc3)cc2)C1 |
| InChI | InChI=1S/C26H31N3O3/c1-19(30)28(2)23-16-17-29(18-23)22-12-10-21(11-13-22)27-26(31)20-8-14-25(15-9-20)32-24-6-4-3-5-7-24/h4,6,8-15,23-24H,3,5,7,16-18H2,1-2H3,(H,27,31) |
| InChIKey | XCROEOQMZPSCFY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|