C26H35N3O2 — CID 58867737
4-(cyclohexylmethoxy)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]benzamide (PubChem CID 58867737) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 4-(cyclohexylmethoxy)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]benzamide.
| Compound Name | 4-(cyclohexylmethoxy)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 58867737 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 4-(cyclohexylmethoxy)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]benzamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)c3ccc(OCC4CCCCC4)cc3)cc2)C1 |
| InChI | InChI=1S/C26H35N3O2/c1-28(2)24-16-17-29(18-24)23-12-10-22(11-13-23)27-26(30)21-8-14-25(15-9-21)31-19-20-6-4-3-5-7-20/h8-15,20,24H,3-7,16-19H2,1-2H3,(H,27,30) |
| InChIKey | QIVJVCGLXGDDJZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|