C24H29N5O2 — CID 90751752
N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-[(6-methyl-4,5-dihydropyridazin-3-yl)oxy]benzamide (PubChem CID 90751752) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-[(6-methyl-4,5-dihydropyridazin-3-yl)oxy]benzamide.
| Compound Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-[(6-methyl-4,5-dihydropyridazin-3-yl)oxy]benzamide |
|---|---|
| PubChem CID | 90751752 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-[(6-methyl-4,5-dihydropyridazin-3-yl)oxy]benzamide |
| SMILES | CC1=NN=C(Oc2ccc(C(=O)Nc3ccc(N4CCC(N(C)C)C4)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H29N5O2/c1-17-4-13-23(27-26-17)31-22-11-5-18(6-12-22)24(30)25-19-7-9-20(10-8-19)29-15-14-21(16-29)28(2)3/h5-12,21H,4,13-16H2,1-3H3,(H,25,30) |
| InChIKey | PEWYURIXFRTZSM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|