C22H27N5O — CID 142931733
4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]benzamide (PubChem CID 142931733) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]benzamide.
| Compound Name | 4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 142931733 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]benzamide |
| SMILES | [H]/N=C/C(=C\N)c1ccc(C(=O)Nc2ccc(N3CCC(N(C)C)C3)cc2)cc1 |
| InChI | InChI=1S/C22H27N5O/c1-26(2)21-11-12-27(15-21)20-9-7-19(8-10-20)25-22(28)17-5-3-16(4-6-17)18(13-23)14-24/h3-10,13-14,21,23H,11-12,15,24H2,1-2H3,(H,25,28)/b18-14+,23-13+ |
| InChIKey | OWQRKQLJGKAHPP-JYNNYDOQSA-N |
| XLogP | 3.03 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|