C23H31N5O4 — CID 91416291
3-(dihydroxyamino)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-morpholin-4-ylbenzamide (PubChem CID 91416291) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-(dihydroxyamino)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-morpholin-4-ylbenzamide.
| Compound Name | 3-(dihydroxyamino)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 91416291 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 3-(dihydroxyamino)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-morpholin-4-ylbenzamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)c3ccc(N4CCOCC4)c(N(O)O)c3)cc2)C1 |
| InChI | InChI=1S/C23H31N5O4/c1-25(2)20-9-10-27(16-20)19-6-4-18(5-7-19)24-23(29)17-3-8-21(22(15-17)28(30)31)26-11-13-32-14-12-26/h3-8,15,20,30-31H,9-14,16H2,1-2H3,(H,24,29) |
| InChIKey | SATDHEBENIQCFU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|