C25H31FN4O3 — CID 58866718
4-(1-acetylpyrrolidin-3-yl)oxy-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-fluorobenzamide (PubChem CID 58866718) has the molecular formula C25H31FN4O3 and a molecular weight of 454.55 g/mol. Its IUPAC name is 4-(1-acetylpyrrolidin-3-yl)oxy-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-fluorobenzamide.
| Compound Name | 4-(1-acetylpyrrolidin-3-yl)oxy-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 58866718 |
| Molecular Formula | C25H31FN4O3 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 4-(1-acetylpyrrolidin-3-yl)oxy-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-fluorobenzamide |
| SMILES | CC(=O)N1CCC(Oc2ccc(C(=O)Nc3ccc(N4CCC(N(C)C)C4)cc3)cc2F)C1 |
| InChI | InChI=1S/C25H31FN4O3/c1-17(31)29-13-11-22(16-29)33-24-9-4-18(14-23(24)26)25(32)27-19-5-7-20(8-6-19)30-12-10-21(15-30)28(2)3/h4-9,14,21-22H,10-13,15-16H2,1-3H3,(H,27,32) |
| InChIKey | AHQCLOXVANWGDO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|