C24H25FN4O — CID 58866428
N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-(3-fluoro-4-pyridinyl)benzamide (PubChem CID 58866428) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-(3-fluoro-4-pyridinyl)benzamide.
| Compound Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-(3-fluoro-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 58866428 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-4-(3-fluoro-4-pyridinyl)benzamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)c3ccc(-c4ccncc4F)cc3)cc2)C1 |
| InChI | InChI=1S/C24H25FN4O/c1-28(2)21-12-14-29(16-21)20-9-7-19(8-10-20)27-24(30)18-5-3-17(4-6-18)22-11-13-26-15-23(22)25/h3-11,13,15,21H,12,14,16H2,1-2H3,(H,27,30) |
| InChIKey | ITFDXIWCJKETDB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|