C26H27N3O4S — CID 67147935
N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-(benzenesulfonyl)benzamide (PubChem CID 67147935) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-(benzenesulfonyl)benzamide.
| Compound Name | N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-(benzenesulfonyl)benzamide |
|---|---|
| PubChem CID | 67147935 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[4-[3-[acetyl(methyl)amino]pyrrolidin-1-yl]phenyl]-4-(benzenesulfonyl)benzamide |
| SMILES | CC(=O)N(C)C1CCN(c2ccc(NC(=O)c3ccc(S(=O)(=O)c4ccccc4)cc3)cc2)C1 |
| InChI | InChI=1S/C26H27N3O4S/c1-19(30)28(2)23-16-17-29(18-23)22-12-10-21(11-13-22)27-26(31)20-8-14-25(15-9-20)34(32,33)24-6-4-3-5-7-24/h3-15,23H,16-18H2,1-2H3,(H,27,31) |
| InChIKey | KUJHJTWGOXTAJD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|