C24H31N3O3 — CID 131944928
4-(4-methylpiperazin-1-yl)-N-[4-(oxan-2-ylmethoxy)phenyl]benzamide (PubChem CID 131944928) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-N-[4-(oxan-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-N-[4-(oxan-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 131944928 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-N-[4-(oxan-2-ylmethoxy)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3ccc(OCC4CCCCO4)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H31N3O3/c1-26-13-15-27(16-14-26)21-9-5-19(6-10-21)24(28)25-20-7-11-22(12-8-20)30-18-23-4-2-3-17-29-23/h5-12,23H,2-4,13-18H2,1H3,(H,25,28) |
| InChIKey | JZKCZYYSURPICD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |